C14H28O2Si2 — CID 10946011
tert-butyl-dimethyl-[(1R)-1-[(2S)-oxiran-2-yl]-3-trimethylsilylprop-2-ynoxy]silane (PubChem CID 10946011) has the molecular formula C14H28O2Si2 and a molecular weight of 284.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R)-1-[(2S)-oxiran-2-yl]-3-trimethylsilylprop-2-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R)-1-[(2S)-oxiran-2-yl]-3-trimethylsilylprop-2-ynoxy]silane |
|---|---|
| PubChem CID | 10946011 |
| Molecular Formula | C14H28O2Si2 |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl-dimethyl-[(1R)-1-[(2S)-oxiran-2-yl]-3-trimethylsilylprop-2-ynoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C#C[Si](C)(C)C)[C@@H]1CO1 |
| InChI | InChI=1S/C14H28O2Si2/c1-14(2,3)18(7,8)16-12(13-11-15-13)9-10-17(4,5)6/h12-13H,11H2,1-8H3/t12-,13+/m1/s1 |
| InChIKey | PAOFSQICXLYYTG-OLZOCXBDSA-N |
| XLogP | 3.66 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|