C12H24O3 — CID 135016264
(4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-ol (PubChem CID 135016264) has the molecular formula C12H24O3 and a molecular weight of 216.32 g/mol. Its IUPAC name is (4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-ol.
| Compound Name | (4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-ol |
|---|---|
| PubChem CID | 135016264 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (4R,5S)-4-(methoxymethoxy)-5-methylnon-1-en-3-ol |
| SMILES | C=CC(O)[C@H](OCOC)[C@@H](C)CCCC |
| InChI | InChI=1S/C12H24O3/c1-5-7-8-10(3)12(11(13)6-2)15-9-14-4/h6,10-13H,2,5,7-9H2,1,3-4H3/t10-,11?,12+/m0/s1 |
| InChIKey | OYQPFHUEDLTCPS-ASKATJPDSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|