C16H32O2 — CID 134207773
4,8-dimethyl-8-pentoxynon-1-en-3-ol (PubChem CID 134207773) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 4,8-dimethyl-8-pentoxynon-1-en-3-ol.
| Compound Name | 4,8-dimethyl-8-pentoxynon-1-en-3-ol |
|---|---|
| PubChem CID | 134207773 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 4,8-dimethyl-8-pentoxynon-1-en-3-ol |
| SMILES | C=CC(O)C(C)CCCC(C)(C)OCCCCC |
| InChI | InChI=1S/C16H32O2/c1-6-8-9-13-18-16(4,5)12-10-11-14(3)15(17)7-2/h7,14-15,17H,2,6,8-13H2,1,3-5H3 |
| InChIKey | NYSFNNXYKLJLAZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|