C14H24O7 — CID 11255150
(3S,4S,5R,6R)-4,5,6-tris(methoxymethoxy)oct-1-en-7-yn-3-ol (PubChem CID 11255150) has the molecular formula C14H24O7 and a molecular weight of 304.34 g/mol. Its IUPAC name is (3S,4S,5R,6R)-4,5,6-tris(methoxymethoxy)oct-1-en-7-yn-3-ol.
| Compound Name | (3S,4S,5R,6R)-4,5,6-tris(methoxymethoxy)oct-1-en-7-yn-3-ol |
|---|---|
| PubChem CID | 11255150 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3S,4S,5R,6R)-4,5,6-tris(methoxymethoxy)oct-1-en-7-yn-3-ol |
| SMILES | C#C[C@@H](OCOC)[C@@H](OCOC)[C@@H](OCOC)[C@@H](O)C=C |
| InChI | InChI=1S/C14H24O7/c1-6-11(15)13(20-9-17-4)14(21-10-18-5)12(7-2)19-8-16-3/h2,6,11-15H,1,8-10H2,3-5H3/t11-,12+,13-,14+/m0/s1 |
| InChIKey | CDKIPXGKTUZBST-RFQIPJPRSA-N |
| XLogP | 0.13 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|