C11H17NO4 — CID 102288316
(2E,4S,5S)-4,5-bis(methoxymethoxy)hepta-2,6-dienenitrile (PubChem CID 102288316) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (2E,4S,5S)-4,5-bis(methoxymethoxy)hepta-2,6-dienenitrile.
| Compound Name | (2E,4S,5S)-4,5-bis(methoxymethoxy)hepta-2,6-dienenitrile |
|---|---|
| PubChem CID | 102288316 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (2E,4S,5S)-4,5-bis(methoxymethoxy)hepta-2,6-dienenitrile |
| SMILES | C=C[C@H](OCOC)[C@H](/C=C/C#N)OCOC |
| InChI | InChI=1S/C11H17NO4/c1-4-10(15-8-13-2)11(6-5-7-12)16-9-14-3/h4-6,10-11H,1,8-9H2,2-3H3/b6-5+/t10-,11-/m0/s1 |
| InChIKey | ZCCMHGQFAJJMOF-PZIAFJOJSA-N |
| XLogP | 1.23 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|