C12H18O5 — CID 122403486
(2E,4E,6R,7R)-6-methoxy-7-(methoxymethoxy)nona-2,4,8-trienoic acid (PubChem CID 122403486) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2E,4E,6R,7R)-6-methoxy-7-(methoxymethoxy)nona-2,4,8-trienoic acid.
| Compound Name | (2E,4E,6R,7R)-6-methoxy-7-(methoxymethoxy)nona-2,4,8-trienoic acid |
|---|---|
| PubChem CID | 122403486 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2E,4E,6R,7R)-6-methoxy-7-(methoxymethoxy)nona-2,4,8-trienoic acid |
| SMILES | C=C[C@@H](OCOC)[C@@H](/C=C/C=C/C(=O)O)OC |
| InChI | InChI=1S/C12H18O5/c1-4-10(17-9-15-2)11(16-3)7-5-6-8-12(13)14/h4-8,10-11H,1,9H2,2-3H3,(H,13,14)/b7-5+,8-6+/t10-,11-/m1/s1 |
| InChIKey | HNHMXJRBZVKSRR-JISVGDSBSA-N |
| XLogP | 1.37 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|