C8H15NO4 — CID 139834597
3,4-bis(methoxymethoxy)butanenitrile (PubChem CID 139834597) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3,4-bis(methoxymethoxy)butanenitrile.
| Compound Name | 3,4-bis(methoxymethoxy)butanenitrile |
|---|---|
| PubChem CID | 139834597 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3,4-bis(methoxymethoxy)butanenitrile |
| SMILES | COCOCC(CC#N)OCOC |
| InChI | InChI=1S/C8H15NO4/c1-10-6-12-5-8(3-4-9)13-7-11-2/h8H,3,5-7H2,1-2H3 |
| InChIKey | XWBHKOACTBVYPV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|