C10H19NO2 — CID 101255665
(3S,5R)-3,5-diethoxyhexanenitrile (PubChem CID 101255665) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (3S,5R)-3,5-diethoxyhexanenitrile.
| Compound Name | (3S,5R)-3,5-diethoxyhexanenitrile |
|---|---|
| PubChem CID | 101255665 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3S,5R)-3,5-diethoxyhexanenitrile |
| SMILES | CCO[C@@H](CC#N)C[C@@H](C)OCC |
| InChI | InChI=1S/C10H19NO2/c1-4-12-9(3)8-10(6-7-11)13-5-2/h9-10H,4-6,8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | UTODFTLSNYWXLU-ZJUUUORDSA-N |
| XLogP | 2.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |