About (3S,5R)-3,5-diethoxyhexanenitrile
(3S,5R)-3,5-diethoxyhexanenitrile (PubChem CID 101255665) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (3S,5R)-3,5-diethoxyhexanenitrile.
Molecular Properties
| Compound Name | (3S,5R)-3,5-diethoxyhexanenitrile |
| PubChem CID | 101255665 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (3S,5R)-3,5-diethoxyhexanenitrile |
| SMILES | CCO[C@@H](CC#N)C[C@@H](C)OCC |
| InChI | InChI=1S/C10H19NO2/c1-4-12-9(3)8-10(6-7-11)13-5-2/h9-10H,4-6,8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | UTODFTLSNYWXLU-ZJUUUORDSA-N |
| XLogP | 2.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,5R)-3,5-diethoxyhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-diethoxyhexanenitrile?
The IUPAC name of (3S,5R)-3,5-diethoxyhexanenitrile (CID 101255665) is (3S,5R)-3,5-diethoxyhexanenitrile.
What is the SMILES notation for (3S,5R)-3,5-diethoxyhexanenitrile?
The canonical SMILES for (3S,5R)-3,5-diethoxyhexanenitrile is CCO[C@@H](CC#N)C[C@@H](C)OCC.
What is the InChIKey of (3S,5R)-3,5-diethoxyhexanenitrile?
The InChIKey is UTODFTLSNYWXLU-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H19NO2/c1-4-12-9(3)8-10(6-7-11)13-5-2/h9-10H,4-6,8H2,1-3H3/t9-,10+/m1/s1.
What are the key properties of (3S,5R)-3,5-diethoxyhexanenitrile?
(3S,5R)-3,5-diethoxyhexanenitrile has a molecular weight of 185.27 g/mol, XLogP of 2.12, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-diethoxyhexanenitrile is sourced from PubChem (CID 101255665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).