About 1-chloro-1,3-diethoxybutane
1-chloro-1,3-diethoxybutane (PubChem CID 15602163) has the molecular formula C8H17ClO2
and a molecular weight of 180.67 g/mol. Its IUPAC name is 1-chloro-1,3-diethoxybutane.
Molecular Properties
| Compound Name | 1-chloro-1,3-diethoxybutane |
| PubChem CID | 15602163 |
| Molecular Formula | C8H17ClO2 |
| Molecular Weight | 180.67 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-chloro-1,3-diethoxybutane |
| SMILES | CCOC(C)CC(Cl)OCC |
| InChI | InChI=1S/C8H17ClO2/c1-4-10-7(3)6-8(9)11-5-2/h7-8H,4-6H2,1-3H3 |
| InChIKey | LQUHMIRBBMHRTN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.67 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,3-diethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,3-diethoxybutane?
The IUPAC name of 1-chloro-1,3-diethoxybutane (CID 15602163) is 1-chloro-1,3-diethoxybutane.
What is the SMILES notation for 1-chloro-1,3-diethoxybutane?
The canonical SMILES for 1-chloro-1,3-diethoxybutane is CCOC(C)CC(Cl)OCC.
What is the InChIKey of 1-chloro-1,3-diethoxybutane?
The InChIKey is LQUHMIRBBMHRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17ClO2/c1-4-10-7(3)6-8(9)11-5-2/h7-8H,4-6H2,1-3H3.
What are the key properties of 1-chloro-1,3-diethoxybutane?
1-chloro-1,3-diethoxybutane has a molecular weight of 180.67 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,3-diethoxybutane is sourced from PubChem (CID 15602163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).