About 2-ethoxy-5,7-dimethyloctan-4-ol
2-ethoxy-5,7-dimethyloctan-4-ol (PubChem CID 134339583) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-ethoxy-5,7-dimethyloctan-4-ol.
Molecular Properties
| Compound Name | 2-ethoxy-5,7-dimethyloctan-4-ol |
| PubChem CID | 134339583 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2-ethoxy-5,7-dimethyloctan-4-ol |
| SMILES | CCOC(C)CC(O)C(C)CC(C)C |
| InChI | InChI=1S/C12H26O2/c1-6-14-11(5)8-12(13)10(4)7-9(2)3/h9-13H,6-8H2,1-5H3 |
| InChIKey | OXQAKOZMINHFFB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-5,7-dimethyloctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5,7-dimethyloctan-4-ol?
The IUPAC name of 2-ethoxy-5,7-dimethyloctan-4-ol (CID 134339583) is 2-ethoxy-5,7-dimethyloctan-4-ol.
What is the SMILES notation for 2-ethoxy-5,7-dimethyloctan-4-ol?
The canonical SMILES for 2-ethoxy-5,7-dimethyloctan-4-ol is CCOC(C)CC(O)C(C)CC(C)C.
What is the InChIKey of 2-ethoxy-5,7-dimethyloctan-4-ol?
The InChIKey is OXQAKOZMINHFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-6-14-11(5)8-12(13)10(4)7-9(2)3/h9-13H,6-8H2,1-5H3.
What are the key properties of 2-ethoxy-5,7-dimethyloctan-4-ol?
2-ethoxy-5,7-dimethyloctan-4-ol has a molecular weight of 202.34 g/mol, XLogP of 2.84, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5,7-dimethyloctan-4-ol is sourced from PubChem (CID 134339583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).