About 3,3-diethoxypropanenitrile;sulfuric acid
3,3-diethoxypropanenitrile;sulfuric acid (PubChem CID 174960447) has the molecular formula C7H15NO6S
and a molecular weight of 241.26 g/mol. Its IUPAC name is 3,3-diethoxypropanenitrile;sulfuric acid.
Molecular Properties
| Compound Name | 3,3-diethoxypropanenitrile;sulfuric acid |
| PubChem CID | 174960447 |
| Molecular Formula | C7H15NO6S |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3,3-diethoxypropanenitrile;sulfuric acid |
| SMILES | CCOC(CC#N)OCC.O=S(=O)(O)O |
| InChI | InChI=1S/C7H13NO2.H2O4S/c1-3-9-7(5-6-8)10-4-2;1-5(2,3)4/h7H,3-5H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | JVRNKRSHKFPPCZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxypropanenitrile;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxypropanenitrile;sulfuric acid?
The IUPAC name of 3,3-diethoxypropanenitrile;sulfuric acid (CID 174960447) is 3,3-diethoxypropanenitrile;sulfuric acid.
What is the SMILES notation for 3,3-diethoxypropanenitrile;sulfuric acid?
The canonical SMILES for 3,3-diethoxypropanenitrile;sulfuric acid is CCOC(CC#N)OCC.O=S(=O)(O)O.
What is the InChIKey of 3,3-diethoxypropanenitrile;sulfuric acid?
The InChIKey is JVRNKRSHKFPPCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.H2O4S/c1-3-9-7(5-6-8)10-4-2;1-5(2,3)4/h7H,3-5H2,1-2H3;(H2,1,2,3,4).
What are the key properties of 3,3-diethoxypropanenitrile;sulfuric acid?
3,3-diethoxypropanenitrile;sulfuric acid has a molecular weight of 241.26 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxypropanenitrile;sulfuric acid is sourced from PubChem (CID 174960447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).