C7H15NO6S — CID 174960447
3,3-diethoxypropanenitrile;sulfuric acid (PubChem CID 174960447) has the molecular formula C7H15NO6S and a molecular weight of 241.26 g/mol. Its IUPAC name is 3,3-diethoxypropanenitrile;sulfuric acid.
| Compound Name | 3,3-diethoxypropanenitrile;sulfuric acid |
|---|---|
| PubChem CID | 174960447 |
| Molecular Formula | C7H15NO6S |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3,3-diethoxypropanenitrile;sulfuric acid |
| SMILES | CCOC(CC#N)OCC.O=S(=O)(O)O |
| InChI | InChI=1S/C7H13NO2.H2O4S/c1-3-9-7(5-6-8)10-4-2;1-5(2,3)4/h7H,3-5H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | JVRNKRSHKFPPCZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|