C6H15NO8S2 — CID 15889424
2,2-diethoxyethyl(sulfo)sulfamic acid (PubChem CID 15889424) has the molecular formula C6H15NO8S2 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2,2-diethoxyethyl(sulfo)sulfamic acid.
| Compound Name | 2,2-diethoxyethyl(sulfo)sulfamic acid |
|---|---|
| PubChem CID | 15889424 |
| Molecular Formula | C6H15NO8S2 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 2,2-diethoxyethyl(sulfo)sulfamic acid |
| SMILES | CCOC(CN(S(=O)(=O)O)S(=O)(=O)O)OCC |
| InChI | InChI=1S/C6H15NO8S2/c1-3-14-6(15-4-2)5-7(16(8,9)10)17(11,12)13/h6H,3-5H2,1-2H3,(H,8,9,10)(H,11,12,13) |
| InChIKey | JUJKRHSLMOMSDP-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|