C4H11NO8S2 — CID 15889422
2,2-dimethoxyethyl(sulfo)sulfamic acid (PubChem CID 15889422) has the molecular formula C4H11NO8S2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2,2-dimethoxyethyl(sulfo)sulfamic acid.
| Compound Name | 2,2-dimethoxyethyl(sulfo)sulfamic acid |
|---|---|
| PubChem CID | 15889422 |
| Molecular Formula | C4H11NO8S2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 2,2-dimethoxyethyl(sulfo)sulfamic acid |
| SMILES | COC(CN(S(=O)(=O)O)S(=O)(=O)O)OC |
| InChI | InChI=1S/C4H11NO8S2/c1-12-4(13-2)3-5(14(6,7)8)15(9,10)11/h4H,3H2,1-2H3,(H,6,7,8)(H,9,10,11) |
| InChIKey | DEBQCZVAWWWTJS-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|