C13H19NO5S — CID 3724820
4-acetyl-N-(2,2-dimethoxyethyl)-N-methylbenzenesulfonamide (PubChem CID 3724820) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-acetyl-N-(2,2-dimethoxyethyl)-N-methylbenzenesulfonamide.
| Compound Name | 4-acetyl-N-(2,2-dimethoxyethyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3724820 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-acetyl-N-(2,2-dimethoxyethyl)-N-methylbenzenesulfonamide |
| SMILES | COC(CN(C)S(=O)(=O)c1ccc(C(C)=O)cc1)OC |
| InChI | InChI=1S/C13H19NO5S/c1-10(15)11-5-7-12(8-6-11)20(16,17)14(2)9-13(18-3)19-4/h5-8,13H,9H2,1-4H3 |
| InChIKey | WZAYQKIAMLGBOS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|