C9H20N2O3 — CID 13172165
1-tert-butyl-1-(2,2-dimethoxyethyl)urea (PubChem CID 13172165) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-tert-butyl-1-(2,2-dimethoxyethyl)urea.
| Compound Name | 1-tert-butyl-1-(2,2-dimethoxyethyl)urea |
|---|---|
| PubChem CID | 13172165 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-tert-butyl-1-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CN(C(N)=O)C(C)(C)C)OC |
| InChI | InChI=1S/C9H20N2O3/c1-9(2,3)11(8(10)12)6-7(13-4)14-5/h7H,6H2,1-5H3,(H2,10,12) |
| InChIKey | WBFASNFWJJOGAZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|