C13H26N2O5 — CID 138610691
tert-butyl-[3-[tert-butyl(carboxy)amino]-2-hydroxypropyl]carbamic acid (PubChem CID 138610691) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(carboxy)amino]-2-hydroxypropyl]carbamic acid.
| Compound Name | tert-butyl-[3-[tert-butyl(carboxy)amino]-2-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 138610691 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(carboxy)amino]-2-hydroxypropyl]carbamic acid |
| SMILES | CC(C)(C)N(CC(O)CN(C(=O)O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H26N2O5/c1-12(2,3)14(10(17)18)7-9(16)8-15(11(19)20)13(4,5)6/h9,16H,7-8H2,1-6H3,(H,17,18)(H,19,20) |
| InChIKey | BMROMKIRMWGJQT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |