C12H26N2O5 — CID 175409845
[3-[bis(2-hydroxyethyl)amino]-2-hydroxypropyl]-tert-butylcarbamic acid (PubChem CID 175409845) has the molecular formula C12H26N2O5 and a molecular weight of 278.35 g/mol. Its IUPAC name is [3-[bis(2-hydroxyethyl)amino]-2-hydroxypropyl]-tert-butylcarbamic acid.
| Compound Name | [3-[bis(2-hydroxyethyl)amino]-2-hydroxypropyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 175409845 |
| Molecular Formula | C12H26N2O5 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [3-[bis(2-hydroxyethyl)amino]-2-hydroxypropyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CC(O)CN(CCO)CCO)C(=O)O |
| InChI | InChI=1S/C12H26N2O5/c1-12(2,3)14(11(18)19)9-10(17)8-13(4-6-15)5-7-16/h10,15-17H,4-9H2,1-3H3,(H,18,19) |
| InChIKey | JNQSNWYEBNMNHF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |