About N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine
N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine (PubChem CID 63619021) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine |
| PubChem CID | 63619021 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine |
| SMILES | CCOC(CN(C)CCC(C)C)OCC |
| InChI | InChI=1S/C12H27NO2/c1-6-14-12(15-7-2)10-13(5)9-8-11(3)4/h11-12H,6-10H2,1-5H3 |
| InChIKey | WVQLWCTXWUSYGH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine?
The IUPAC name of N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine (CID 63619021) is N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine.
What is the SMILES notation for N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine?
The canonical SMILES for N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine is CCOC(CN(C)CCC(C)C)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine?
The InChIKey is WVQLWCTXWUSYGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2/c1-6-14-12(15-7-2)10-13(5)9-8-11(3)4/h11-12H,6-10H2,1-5H3.
What are the key properties of N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine?
N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine has a molecular weight of 217.35 g/mol, XLogP of 2.36, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 63619021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).