C12H27NO2 — CID 63619021
N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine (PubChem CID 63619021) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine.
| Compound Name | N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 63619021 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N-(2,2-diethoxyethyl)-N,3-dimethylbutan-1-amine |
| SMILES | CCOC(CN(C)CCC(C)C)OCC |
| InChI | InChI=1S/C12H27NO2/c1-6-14-12(15-7-2)10-13(5)9-8-11(3)4/h11-12H,6-10H2,1-5H3 |
| InChIKey | WVQLWCTXWUSYGH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|