C10H20N2O2 — CID 63617666
3-[2,2-diethoxyethyl(methyl)amino]propanenitrile (PubChem CID 63617666) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-[2,2-diethoxyethyl(methyl)amino]propanenitrile.
| Compound Name | 3-[2,2-diethoxyethyl(methyl)amino]propanenitrile |
|---|---|
| PubChem CID | 63617666 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 3-[2,2-diethoxyethyl(methyl)amino]propanenitrile |
| SMILES | CCOC(CN(C)CCC#N)OCC |
| InChI | InChI=1S/C10H20N2O2/c1-4-13-10(14-5-2)9-12(3)8-6-7-11/h10H,4-6,8-9H2,1-3H3 |
| InChIKey | LYASPYDTIRFKNP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|