C16H24N2O2 — CID 63628601
3-[N-(3,3-diethoxypropyl)anilino]propanenitrile (PubChem CID 63628601) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-[N-(3,3-diethoxypropyl)anilino]propanenitrile.
| Compound Name | 3-[N-(3,3-diethoxypropyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 63628601 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-[N-(3,3-diethoxypropyl)anilino]propanenitrile |
| SMILES | CCOC(CCN(CCC#N)c1ccccc1)OCC |
| InChI | InChI=1S/C16H24N2O2/c1-3-19-16(20-4-2)11-14-18(13-8-12-17)15-9-6-5-7-10-15/h5-7,9-10,16H,3-4,8,11,13-14H2,1-2H3 |
| InChIKey | ARLFFSCNRHAVSV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|