About 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile
3-[3,3-diethoxypropyl(methyl)amino]propanenitrile (PubChem CID 63628600) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile |
| PubChem CID | 63628600 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile |
| SMILES | CCOC(CCN(C)CCC#N)OCC |
| InChI | InChI=1S/C11H22N2O2/c1-4-14-11(15-5-2)7-10-13(3)9-6-8-12/h11H,4-7,9-10H2,1-3H3 |
| InChIKey | TZFUKPJZRHIYHZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile?
The IUPAC name of 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile (CID 63628600) is 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile.
What is the SMILES notation for 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile?
The canonical SMILES for 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile is CCOC(CCN(C)CCC#N)OCC.
What is the InChIKey of 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile?
The InChIKey is TZFUKPJZRHIYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-4-14-11(15-5-2)7-10-13(3)9-6-8-12/h11H,4-7,9-10H2,1-3H3.
What are the key properties of 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile?
3-[3,3-diethoxypropyl(methyl)amino]propanenitrile has a molecular weight of 214.31 g/mol, XLogP of 1.62, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-diethoxypropyl(methyl)amino]propanenitrile is sourced from PubChem (CID 63628600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).