C14H29NO3 — CID 63712799
3,3-diethoxy-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine (PubChem CID 63712799) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is 3,3-diethoxy-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine.
| Compound Name | 3,3-diethoxy-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 63712799 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 3,3-diethoxy-N-methyl-N-(oxan-4-ylmethyl)propan-1-amine |
| SMILES | CCOC(CCN(C)CC1CCOCC1)OCC |
| InChI | InChI=1S/C14H29NO3/c1-4-17-14(18-5-2)6-9-15(3)12-13-7-10-16-11-8-13/h13-14H,4-12H2,1-3H3 |
| InChIKey | OWNQNMLJRJTNCI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|