C12H24O3S — CID 63630320
4-(3,3-diethoxypropylsulfanyl)oxane (PubChem CID 63630320) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 4-(3,3-diethoxypropylsulfanyl)oxane.
| Compound Name | 4-(3,3-diethoxypropylsulfanyl)oxane |
|---|---|
| PubChem CID | 63630320 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-(3,3-diethoxypropylsulfanyl)oxane |
| SMILES | CCOC(CCSC1CCOCC1)OCC |
| InChI | InChI=1S/C12H24O3S/c1-3-14-12(15-4-2)7-10-16-11-5-8-13-9-6-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | MYOSSIMOIGQZAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|