C14H28O2S — CID 63629815
1-(3,3-diethoxypropylsulfanyl)-3-methylcyclohexane (PubChem CID 63629815) has the molecular formula C14H28O2S and a molecular weight of 260.44 g/mol. Its IUPAC name is 1-(3,3-diethoxypropylsulfanyl)-3-methylcyclohexane.
| Compound Name | 1-(3,3-diethoxypropylsulfanyl)-3-methylcyclohexane |
|---|---|
| PubChem CID | 63629815 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-(3,3-diethoxypropylsulfanyl)-3-methylcyclohexane |
| SMILES | CCOC(CCSC1CCCC(C)C1)OCC |
| InChI | InChI=1S/C14H28O2S/c1-4-15-14(16-5-2)9-10-17-13-8-6-7-12(3)11-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | CKJMWDKRCHARRP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|