C10H17ClS — CID 131233090
1-[(E)-3-chloroprop-2-enyl]sulfanyl-3-methylcyclohexane (PubChem CID 131233090) has the molecular formula C10H17ClS and a molecular weight of 204.77 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]sulfanyl-3-methylcyclohexane.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]sulfanyl-3-methylcyclohexane |
|---|---|
| PubChem CID | 131233090 |
| Molecular Formula | C10H17ClS |
| Molecular Weight | 204.77 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]sulfanyl-3-methylcyclohexane |
| SMILES | CC1CCCC(SC/C=C/Cl)C1 |
| InChI | InChI=1S/C10H17ClS/c1-9-4-2-5-10(8-9)12-7-3-6-11/h3,6,9-10H,2,4-5,7-8H2,1H3/b6-3+ |
| InChIKey | ASNDENQUULXNPP-ZZXKWVIFSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |