C10H20O2S — CID 79683415
3-(3-methylcyclohexyl)sulfanylpropane-1,2-diol (PubChem CID 79683415) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is 3-(3-methylcyclohexyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(3-methylcyclohexyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79683415 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3-(3-methylcyclohexyl)sulfanylpropane-1,2-diol |
| SMILES | CC1CCCC(SCC(O)CO)C1 |
| InChI | InChI=1S/C10H20O2S/c1-8-3-2-4-10(5-8)13-7-9(12)6-11/h8-12H,2-7H2,1H3 |
| InChIKey | CUBQWSLTTANWFD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |