C14H27BrS — CID 65016282
1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfanyl-3-methylcyclohexane (PubChem CID 65016282) has the molecular formula C14H27BrS and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfanyl-3-methylcyclohexane.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfanyl-3-methylcyclohexane |
|---|---|
| PubChem CID | 65016282 |
| Molecular Formula | C14H27BrS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutyl]sulfanyl-3-methylcyclohexane |
| SMILES | CC1CCCC(SCC(CBr)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H27BrS/c1-11-6-5-7-13(8-11)16-10-12(9-15)14(2,3)4/h11-13H,5-10H2,1-4H3 |
| InChIKey | ZNLFHJSMKQCTOC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|