C11H23NO2S — CID 79671709
3-[3-(propylamino)cyclopentyl]sulfanylpropane-1,2-diol (PubChem CID 79671709) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-[3-(propylamino)cyclopentyl]sulfanylpropane-1,2-diol.
| Compound Name | 3-[3-(propylamino)cyclopentyl]sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 79671709 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-[3-(propylamino)cyclopentyl]sulfanylpropane-1,2-diol |
| SMILES | CCCNC1CCC(SCC(O)CO)C1 |
| InChI | InChI=1S/C11H23NO2S/c1-2-5-12-9-3-4-11(6-9)15-8-10(14)7-13/h9-14H,2-8H2,1H3 |
| InChIKey | FCZPOEFLYYTVRN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |