C11H19N3S — CID 107783909
3-(1H-imidazol-2-ylsulfanyl)-N-propylcyclopentan-1-amine (PubChem CID 107783909) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is 3-(1H-imidazol-2-ylsulfanyl)-N-propylcyclopentan-1-amine.
| Compound Name | 3-(1H-imidazol-2-ylsulfanyl)-N-propylcyclopentan-1-amine |
|---|---|
| PubChem CID | 107783909 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-(1H-imidazol-2-ylsulfanyl)-N-propylcyclopentan-1-amine |
| SMILES | CCCNC1CCC(Sc2ncc[nH]2)C1 |
| InChI | InChI=1S/C11H19N3S/c1-2-5-12-9-3-4-10(8-9)15-11-13-6-7-14-11/h6-7,9-10,12H,2-5,8H2,1H3,(H,13,14) |
| InChIKey | AJYXWVFXJSQKFI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |