C8H13N3S — CID 18723020
2-(1-methylpyrrolidin-3-yl)sulfanyl-1H-imidazole (PubChem CID 18723020) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-3-yl)sulfanyl-1H-imidazole.
| Compound Name | 2-(1-methylpyrrolidin-3-yl)sulfanyl-1H-imidazole |
|---|---|
| PubChem CID | 18723020 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(1-methylpyrrolidin-3-yl)sulfanyl-1H-imidazole |
| SMILES | CN1CCC(Sc2ncc[nH]2)C1 |
| InChI | InChI=1S/C8H13N3S/c1-11-5-2-7(6-11)12-8-9-3-4-10-8/h3-4,7H,2,5-6H2,1H3,(H,9,10) |
| InChIKey | DRYKLQYOVWWOBS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |