C20H23N5O2S2 — CID 87913938
[4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(1H-imidazol-2-ylsulfanyl)piperidine-1-carboxylate (PubChem CID 87913938) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(1H-imidazol-2-ylsulfanyl)piperidine-1-carboxylate.
| Compound Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(1H-imidazol-2-ylsulfanyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87913938 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(1H-imidazol-2-ylsulfanyl)piperidine-1-carboxylate |
| SMILES | Cn1ccnc1C(S)c1ccc(OC(=O)N2CCC(Sc3ncc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5O2S2/c1-24-13-10-21-18(24)17(28)14-2-4-15(5-3-14)27-20(26)25-11-6-16(7-12-25)29-19-22-8-9-23-19/h2-5,8-10,13,16-17,28H,6-7,11-12H2,1H3,(H,22,23) |
| InChIKey | YVAOCDNSWGVKNN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|