C21H25N5O2S2 — CID 87940585
[4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboxylate (PubChem CID 87940585) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87940585 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboxylate |
| SMILES | Cn1ccnc1C(S)c1ccc(OC(=O)N2CCN(CCc3nccs3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O2S2/c1-24-10-7-23-20(24)19(29)16-2-4-17(5-3-16)28-21(27)26-13-11-25(12-14-26)9-6-18-22-8-15-30-18/h2-5,7-8,10,15,19,29H,6,9,11-14H2,1H3 |
| InChIKey | HSCCDUQSBAKDJB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|