C23H27N5O2S — CID 87940474
[4-[1H-imidazol-2-yl(sulfanyl)methyl]phenyl] 4-(3-pyridin-2-ylpropyl)piperazine-1-carboxylate (PubChem CID 87940474) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is [4-[1H-imidazol-2-yl(sulfanyl)methyl]phenyl] 4-(3-pyridin-2-ylpropyl)piperazine-1-carboxylate.
| Compound Name | [4-[1H-imidazol-2-yl(sulfanyl)methyl]phenyl] 4-(3-pyridin-2-ylpropyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87940474 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [4-[1H-imidazol-2-yl(sulfanyl)methyl]phenyl] 4-(3-pyridin-2-ylpropyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc(C(S)c2ncc[nH]2)cc1)N1CCN(CCCc2ccccn2)CC1 |
| InChI | InChI=1S/C23H27N5O2S/c29-23(30-20-8-6-18(7-9-20)21(31)22-25-11-12-26-22)28-16-14-27(15-17-28)13-3-5-19-4-1-2-10-24-19/h1-2,4,6-12,21,31H,3,5,13-17H2,(H,25,26) |
| InChIKey | LEQQMIHMRRNUJQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|