C25H28N4O2S — CID 57456083
[4-(2-pyridin-2-ylsulfanylethyl)phenyl] 4-(2-pyridin-2-ylethyl)piperazine-1-carboxylate (PubChem CID 57456083) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is [4-(2-pyridin-2-ylsulfanylethyl)phenyl] 4-(2-pyridin-2-ylethyl)piperazine-1-carboxylate.
| Compound Name | [4-(2-pyridin-2-ylsulfanylethyl)phenyl] 4-(2-pyridin-2-ylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57456083 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | [4-(2-pyridin-2-ylsulfanylethyl)phenyl] 4-(2-pyridin-2-ylethyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc(CCSc2ccccn2)cc1)N1CCN(CCc2ccccn2)CC1 |
| InChI | InChI=1S/C25H28N4O2S/c30-25(29-18-16-28(17-19-29)15-11-22-5-1-3-13-26-22)31-23-9-7-21(8-10-23)12-20-32-24-6-2-4-14-27-24/h1-10,13-14H,11-12,15-20H2 |
| InChIKey | QGXFFGNXMWZYNJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |