C23H25N5O2S — CID 57455912
[4-(2-pyridin-4-ylsulfanylethyl)phenyl] 4-(pyrazin-2-ylmethyl)piperazine-1-carboxylate (PubChem CID 57455912) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is [4-(2-pyridin-4-ylsulfanylethyl)phenyl] 4-(pyrazin-2-ylmethyl)piperazine-1-carboxylate.
| Compound Name | [4-(2-pyridin-4-ylsulfanylethyl)phenyl] 4-(pyrazin-2-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57455912 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [4-(2-pyridin-4-ylsulfanylethyl)phenyl] 4-(pyrazin-2-ylmethyl)piperazine-1-carboxylate |
| SMILES | O=C(Oc1ccc(CCSc2ccncc2)cc1)N1CCN(Cc2cnccn2)CC1 |
| InChI | InChI=1S/C23H25N5O2S/c29-23(28-14-12-27(13-15-28)18-20-17-25-10-11-26-20)30-21-3-1-19(2-4-21)7-16-31-22-5-8-24-9-6-22/h1-6,8-11,17H,7,12-16,18H2 |
| InChIKey | SYZNEZATACKDBJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |