C25H28N4O2 — CID 11475555
[4-[(5-methyl-2-pyridinyl)methyl]phenyl] 4-(2-pyridin-3-ylethyl)piperazine-1-carboxylate (PubChem CID 11475555) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is [4-[(5-methyl-2-pyridinyl)methyl]phenyl] 4-(2-pyridin-3-ylethyl)piperazine-1-carboxylate.
| Compound Name | [4-[(5-methyl-2-pyridinyl)methyl]phenyl] 4-(2-pyridin-3-ylethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 11475555 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [4-[(5-methyl-2-pyridinyl)methyl]phenyl] 4-(2-pyridin-3-ylethyl)piperazine-1-carboxylate |
| SMILES | Cc1ccc(Cc2ccc(OC(=O)N3CCN(CCc4cccnc4)CC3)cc2)nc1 |
| InChI | InChI=1S/C25H28N4O2/c1-20-4-7-23(27-18-20)17-21-5-8-24(9-6-21)31-25(30)29-15-13-28(14-16-29)12-10-22-3-2-11-26-19-22/h2-9,11,18-19H,10,12-17H2,1H3 |
| InChIKey | LOHCWLGDSYDPMV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |