C25H28N4O2 — CID 57456182
[4-[2-(5-methyl-2-pyridinyl)ethyl]phenyl] 4-(pyridin-2-ylmethyl)piperazine-1-carboxylate (PubChem CID 57456182) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is [4-[2-(5-methyl-2-pyridinyl)ethyl]phenyl] 4-(pyridin-2-ylmethyl)piperazine-1-carboxylate.
| Compound Name | [4-[2-(5-methyl-2-pyridinyl)ethyl]phenyl] 4-(pyridin-2-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57456182 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [4-[2-(5-methyl-2-pyridinyl)ethyl]phenyl] 4-(pyridin-2-ylmethyl)piperazine-1-carboxylate |
| SMILES | Cc1ccc(CCc2ccc(OC(=O)N3CCN(Cc4ccccn4)CC3)cc2)nc1 |
| InChI | InChI=1S/C25H28N4O2/c1-20-5-9-22(27-18-20)10-6-21-7-11-24(12-8-21)31-25(30)29-16-14-28(15-17-29)19-23-4-2-3-13-26-23/h2-5,7-9,11-13,18H,6,10,14-17,19H2,1H3 |
| InChIKey | UWBPEUOVYYNFSX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |