C21H26N6O2S — CID 87940391
[4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1H-imidazol-5-yl)ethyl]piperazine-1-carboxylate (PubChem CID 87940391) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1H-imidazol-5-yl)ethyl]piperazine-1-carboxylate.
| Compound Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1H-imidazol-5-yl)ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87940391 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-[2-(1H-imidazol-5-yl)ethyl]piperazine-1-carboxylate |
| SMILES | Cn1ccnc1C(S)c1ccc(OC(=O)N2CCN(CCc3cnc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H26N6O2S/c1-25-9-7-23-20(25)19(30)16-2-4-18(5-3-16)29-21(28)27-12-10-26(11-13-27)8-6-17-14-22-15-24-17/h2-5,7,9,14-15,19,30H,6,8,10-13H2,1H3,(H,22,24) |
| InChIKey | QAOIPXGWMHICFN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|