C22H25N5O2S — CID 87883014
[4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(6-methyl-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 87883014) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(6-methyl-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(6-methyl-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87883014 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [4-[(1-methylimidazol-2-yl)-sulfanylmethyl]phenyl] 4-(6-methyl-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | Cc1cccc(N2CCN(C(=O)Oc3ccc(C(S)c4nccn4C)cc3)CC2)n1 |
| InChI | InChI=1S/C22H25N5O2S/c1-16-4-3-5-19(24-16)26-12-14-27(15-13-26)22(28)29-18-8-6-17(7-9-18)20(30)21-23-10-11-25(21)2/h3-11,20,30H,12-15H2,1-2H3 |
| InChIKey | VQJKHGKXKPSATA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|