C15H31NO2 — CID 63630283
N-(3,3-diethoxypropyl)-N,3-dimethylcyclohexan-1-amine (PubChem CID 63630283) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N,3-dimethylcyclohexan-1-amine.
| Compound Name | N-(3,3-diethoxypropyl)-N,3-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63630283 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N,3-dimethylcyclohexan-1-amine |
| SMILES | CCOC(CCN(C)C1CCCC(C)C1)OCC |
| InChI | InChI=1S/C15H31NO2/c1-5-17-15(18-6-2)10-11-16(4)14-9-7-8-13(3)12-14/h13-15H,5-12H2,1-4H3 |
| InChIKey | JFCLJEUHQQGIMK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|