C12H25NO4S — CID 63628945
N-(3,3-diethoxypropyl)-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 63628945) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N-methyl-1,1-dioxothiolan-3-amine.
| Compound Name | N-(3,3-diethoxypropyl)-N-methyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 63628945 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CCOC(CCN(C)C1CCS(=O)(=O)C1)OCC |
| InChI | InChI=1S/C12H25NO4S/c1-4-16-12(17-5-2)6-8-13(3)11-7-9-18(14,15)10-11/h11-12H,4-10H2,1-3H3 |
| InChIKey | UUMYKABAPJCUAM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|