C14H30N2 — CID 106799546
1-N-methyl-1-N-(3-methylcyclohexyl)hexane-1,4-diamine (PubChem CID 106799546) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-N-methyl-1-N-(3-methylcyclohexyl)hexane-1,4-diamine.
| Compound Name | 1-N-methyl-1-N-(3-methylcyclohexyl)hexane-1,4-diamine |
|---|---|
| PubChem CID | 106799546 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-N-methyl-1-N-(3-methylcyclohexyl)hexane-1,4-diamine |
| SMILES | CCC(N)CCCN(C)C1CCCC(C)C1 |
| InChI | InChI=1S/C14H30N2/c1-4-13(15)8-6-10-16(3)14-9-5-7-12(2)11-14/h12-14H,4-11,15H2,1-3H3 |
| InChIKey | ZAEGVLAVHPPNCH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |