C17H34BrN — CID 105343672
N-(9-bromononyl)-N,3-dimethylcyclohexan-1-amine (PubChem CID 105343672) has the molecular formula C17H34BrN and a molecular weight of 332.37 g/mol. Its IUPAC name is N-(9-bromononyl)-N,3-dimethylcyclohexan-1-amine.
| Compound Name | N-(9-bromononyl)-N,3-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 105343672 |
| Molecular Formula | C17H34BrN |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-(9-bromononyl)-N,3-dimethylcyclohexan-1-amine |
| SMILES | CC1CCCC(N(C)CCCCCCCCCBr)C1 |
| InChI | InChI=1S/C17H34BrN/c1-16-11-10-12-17(15-16)19(2)14-9-7-5-3-4-6-8-13-18/h16-17H,3-15H2,1-2H3 |
| InChIKey | QBVBCSMCPPKFTK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|