C18H36BrN — CID 105343835
N-(9-bromononyl)-N,4,4-trimethylcyclohexan-1-amine (PubChem CID 105343835) has the molecular formula C18H36BrN and a molecular weight of 346.40 g/mol. Its IUPAC name is N-(9-bromononyl)-N,4,4-trimethylcyclohexan-1-amine.
| Compound Name | N-(9-bromononyl)-N,4,4-trimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 105343835 |
| Molecular Formula | C18H36BrN |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-(9-bromononyl)-N,4,4-trimethylcyclohexan-1-amine |
| SMILES | CN(CCCCCCCCCBr)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C18H36BrN/c1-18(2)13-11-17(12-14-18)20(3)16-10-8-6-4-5-7-9-15-19/h17H,4-16H2,1-3H3 |
| InChIKey | ACSCBDQIIQZUQY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|