C15H29NO2 — CID 79120485
N-hexyl-N-methyl-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 79120485) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-hexyl-N-methyl-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-hexyl-N-methyl-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 79120485 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-hexyl-N-methyl-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | CCCCCCN(C)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H29NO2/c1-3-4-5-6-11-16(2)14-7-9-15(10-8-14)17-12-13-18-15/h14H,3-13H2,1-2H3 |
| InChIKey | XSCKIIIIRUFTQJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|