C9H18O3S — CID 66222578
4-(2,2-dimethoxyethylsulfanyl)oxane (PubChem CID 66222578) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethylsulfanyl)oxane.
| Compound Name | 4-(2,2-dimethoxyethylsulfanyl)oxane |
|---|---|
| PubChem CID | 66222578 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4-(2,2-dimethoxyethylsulfanyl)oxane |
| SMILES | COC(CSC1CCOCC1)OC |
| InChI | InChI=1S/C9H18O3S/c1-10-9(11-2)7-13-8-3-5-12-6-4-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | MEUMWXPAYQMSKV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|