C12H23NO2 — CID 95562319
(2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile (PubChem CID 95562319) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile.
| Compound Name | (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile |
|---|---|
| PubChem CID | 95562319 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile |
| SMILES | CCOC(CC[C@H](C#N)C(C)C)OCC |
| InChI | InChI=1S/C12H23NO2/c1-5-14-12(15-6-2)8-7-11(9-13)10(3)4/h10-12H,5-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | FGRWNYIZKFOLSZ-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|