About (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile
(2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile (PubChem CID 95562319) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile.
Molecular Properties
| Compound Name | (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile |
| PubChem CID | 95562319 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile |
| SMILES | CCOC(CC[C@H](C#N)C(C)C)OCC |
| InChI | InChI=1S/C12H23NO2/c1-5-14-12(15-6-2)8-7-11(9-13)10(3)4/h10-12H,5-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | FGRWNYIZKFOLSZ-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile?
The IUPAC name of (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile (CID 95562319) is (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile.
What is the SMILES notation for (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile?
The canonical SMILES for (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile is CCOC(CC[C@H](C#N)C(C)C)OCC.
What is the InChIKey of (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile?
The InChIKey is FGRWNYIZKFOLSZ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H23NO2/c1-5-14-12(15-6-2)8-7-11(9-13)10(3)4/h10-12H,5-8H2,1-4H3/t11-/m1/s1.
What are the key properties of (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile?
(2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile has a molecular weight of 213.32 g/mol, XLogP of 2.96, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5,5-diethoxy-2-propan-2-ylpentanenitrile is sourced from PubChem (CID 95562319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).