C27H60O18 — CID 54530137
1,2,3-tris(methoxymethoxy)propane (PubChem CID 54530137) has the molecular formula C27H60O18 and a molecular weight of 672.76 g/mol. Its IUPAC name is 1,2,3-tris(methoxymethoxy)propane.
| Compound Name | 1,2,3-tris(methoxymethoxy)propane |
|---|---|
| PubChem CID | 54530137 |
| Molecular Formula | C27H60O18 |
| Molecular Weight | 672.76 g/mol |
| Exact Mass | 672.38 |
| IUPAC Name | 1,2,3-tris(methoxymethoxy)propane |
| SMILES | COCOCC(COCOC)OCOC.COCOCC(COCOC)OCOC.COCOCC(COCOC)OCOC |
| InChI | InChI=1S/3C9H20O6/c3*1-10-6-13-4-9(15-8-12-3)5-14-7-11-2/h3*9H,4-8H2,1-3H3 |
| InChIKey | YVXYLTKBIFQFKL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 166.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.76 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|