C12H21NO4 — CID 165015506
(3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enenitrile (PubChem CID 165015506) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enenitrile.
| Compound Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enenitrile |
|---|---|
| PubChem CID | 165015506 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (3R,4R,5R)-3,5-bis(methoxymethoxy)-4-methylhept-6-enenitrile |
| SMILES | C=C[C@@H](OCOC)[C@H](C)[C@@H](CC#N)OCOC |
| InChI | InChI=1S/C12H21NO4/c1-5-11(16-8-14-3)10(2)12(6-7-13)17-9-15-4/h5,10-12H,1,6,8-9H2,2-4H3/t10-,11+,12+/m0/s1 |
| InChIKey | CEGBDKXIPXEPON-QJPTWQEYSA-N |
| XLogP | 1.70 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|