C13H31NOSi — CID 15632282
(2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyheptan-3-amine (PubChem CID 15632282) has the molecular formula C13H31NOSi and a molecular weight of 245.48 g/mol. Its IUPAC name is (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyheptan-3-amine.
| Compound Name | (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyheptan-3-amine |
|---|---|
| PubChem CID | 15632282 |
| Molecular Formula | C13H31NOSi |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyheptan-3-amine |
| SMILES | CCCC[C@@H](N)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H31NOSi/c1-8-9-10-12(14)11(2)15-16(6,7)13(3,4)5/h11-12H,8-10,14H2,1-7H3/t11-,12+/m0/s1 |
| InChIKey | BXUQBMQAZWRYRN-NWDGAFQWSA-N |
| XLogP | 3.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|